C20H26N4O — CID 126777762
2-phenyl-1-(4-pyridazin-3-yl-1,4-diazepan-1-yl)pentan-1-one (PubChem CID 126777762) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-phenyl-1-(4-pyridazin-3-yl-1,4-diazepan-1-yl)pentan-1-one.
| Compound Name | 2-phenyl-1-(4-pyridazin-3-yl-1,4-diazepan-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 126777762 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-phenyl-1-(4-pyridazin-3-yl-1,4-diazepan-1-yl)pentan-1-one |
| SMILES | CCCC(C(=O)N1CCCN(c2cccnn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H26N4O/c1-2-8-18(17-9-4-3-5-10-17)20(25)24-14-7-13-23(15-16-24)19-11-6-12-21-22-19/h3-6,9-12,18H,2,7-8,13-16H2,1H3 |
| InChIKey | URXAYIONEJIATI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |