About 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid
2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid (PubChem CID 12677807) has the molecular formula C15H16N2O4S
and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid |
| PubChem CID | 12677807 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid |
| SMILES | NCCO.O=C(O)c1cc(=O)c2c([nH]1)-c1ccccc1SC2 |
| InChI | InChI=1S/C13H9NO3S.C2H7NO/c15-10-5-9(13(16)17)14-12-7-3-1-2-4-11(7)18-6-8(10)12;3-1-2-4/h1-5H,6H2,(H,14,15)(H,16,17);4H,1-3H2 |
| InChIKey | LFQAABJSKWFNPJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid?
The IUPAC name of 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid (CID 12677807) is 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid.
What is the SMILES notation for 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid?
The canonical SMILES for 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid is NCCO.O=C(O)c1cc(=O)c2c([nH]1)-c1ccccc1SC2.
What is the InChIKey of 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid?
The InChIKey is LFQAABJSKWFNPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3S.C2H7NO/c15-10-5-9(13(16)17)14-12-7-3-1-2-4-11(7)18-6-8(10)12;3-1-2-4/h1-5H,6H2,(H,14,15)(H,16,17);4H,1-3H2.
What are the key properties of 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid?
2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid has a molecular weight of 320.37 g/mol, XLogP of 1.28, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;4-oxo-1,5-dihydrothiochromeno[4,3-b]pyridine-2-carboxylic acid is sourced from PubChem (CID 12677807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).