About (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol
(1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol (PubChem CID 126778899) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol.
Molecular Properties
| Compound Name | (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol |
| PubChem CID | 126778899 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol |
| SMILES | CCC(C)N1CCC(F)(F)C(CO)C1 |
| InChI | InChI=1S/C10H19F2NO/c1-3-8(2)13-5-4-10(11,12)9(6-13)7-14/h8-9,14H,3-7H2,1-2H3 |
| InChIKey | OYAXZSJBHQQUTB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol?
The IUPAC name of (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol (CID 126778899) is (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol.
What is the SMILES notation for (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol?
The canonical SMILES for (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol is CCC(C)N1CCC(F)(F)C(CO)C1.
What is the InChIKey of (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol?
The InChIKey is OYAXZSJBHQQUTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO/c1-3-8(2)13-5-4-10(11,12)9(6-13)7-14/h8-9,14H,3-7H2,1-2H3.
What are the key properties of (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol?
(1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol has a molecular weight of 207.26 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butan-2-yl-4,4-difluoropiperidin-3-yl)methanol is sourced from PubChem (CID 126778899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).