C21H24N2O3 — CID 126779369
7-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 126779369) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 7-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 126779369 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 7-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | COc1ccc2c(c1)C(Nc1ccc3c(c1)CCCC(=O)N3)CCCO2 |
| InChI | InChI=1S/C21H24N2O3/c1-25-16-8-10-20-17(13-16)19(5-3-11-26-20)22-15-7-9-18-14(12-15)4-2-6-21(24)23-18/h7-10,12-13,19,22H,2-6,11H2,1H3,(H,23,24) |
| InChIKey | SIGDJYGGGGNNNA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |