C18H17ClN4OS — CID 126779570
(3-anilinopyrrolidin-1-yl)-[5-(5-chlorothiophen-2-yl)-1H-pyrazol-4-yl]methanone (PubChem CID 126779570) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is (3-anilinopyrrolidin-1-yl)-[5-(5-chlorothiophen-2-yl)-1H-pyrazol-4-yl]methanone.
| Compound Name | (3-anilinopyrrolidin-1-yl)-[5-(5-chlorothiophen-2-yl)-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 126779570 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (3-anilinopyrrolidin-1-yl)-[5-(5-chlorothiophen-2-yl)-1H-pyrazol-4-yl]methanone |
| SMILES | O=C(c1cn[nH]c1-c1ccc(Cl)s1)N1CCC(Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H17ClN4OS/c19-16-7-6-15(25-16)17-14(10-20-22-17)18(24)23-9-8-13(11-23)21-12-4-2-1-3-5-12/h1-7,10,13,21H,8-9,11H2,(H,20,22) |
| InChIKey | VUDURJRAUFKZJX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |