C21H28ClFN2O2 — CID 126779638
3-[5-(2-fluorophenyl)furan-2-yl]-N-piperidin-4-yl-N-propylpropanamide;hydrochloride (PubChem CID 126779638) has the molecular formula C21H28ClFN2O2 and a molecular weight of 394.92 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-piperidin-4-yl-N-propylpropanamide;hydrochloride.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-piperidin-4-yl-N-propylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 126779638 |
| Molecular Formula | C21H28ClFN2O2 |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-piperidin-4-yl-N-propylpropanamide;hydrochloride |
| SMILES | CCCN(C(=O)CCc1ccc(-c2ccccc2F)o1)C1CCNCC1.Cl |
| InChI | InChI=1S/C21H27FN2O2.ClH/c1-2-15-24(16-11-13-23-14-12-16)21(25)10-8-17-7-9-20(26-17)18-5-3-4-6-19(18)22;/h3-7,9,16,23H,2,8,10-15H2,1H3;1H |
| InChIKey | RLNVIRYEMSUYFK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |