C18H19NO6 — CID 126779802
3-[oxan-4-yl-(4-oxochromene-2-carbonyl)amino]propanoic acid (PubChem CID 126779802) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-[oxan-4-yl-(4-oxochromene-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[oxan-4-yl-(4-oxochromene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 126779802 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-[oxan-4-yl-(4-oxochromene-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)c1cc(=O)c2ccccc2o1)C1CCOCC1 |
| InChI | InChI=1S/C18H19NO6/c20-14-11-16(25-15-4-2-1-3-13(14)15)18(23)19(8-5-17(21)22)12-6-9-24-10-7-12/h1-4,11-12H,5-10H2,(H,21,22) |
| InChIKey | QHLQRQQAKVEHLF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |