About 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid
2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid (PubChem CID 126780878) has the molecular formula C17H20N2O6
and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid |
| PubChem CID | 126780878 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid |
| SMILES | CC1Oc2c(cccc2C(=O)N(CC(=O)O)C2CCOCC2)NC1=O |
| InChI | InChI=1S/C17H20N2O6/c1-10-16(22)18-13-4-2-3-12(15(13)25-10)17(23)19(9-14(20)21)11-5-7-24-8-6-11/h2-4,10-11H,5-9H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | CBBUCWFYUCSLPH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid?
The IUPAC name of 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid (CID 126780878) is 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid.
What is the SMILES notation for 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid?
The canonical SMILES for 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid is CC1Oc2c(cccc2C(=O)N(CC(=O)O)C2CCOCC2)NC1=O.
What is the InChIKey of 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid?
The InChIKey is CBBUCWFYUCSLPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O6/c1-10-16(22)18-13-4-2-3-12(15(13)25-10)17(23)19(9-14(20)21)11-5-7-24-8-6-11/h2-4,10-11H,5-9H2,1H3,(H,18,22)(H,20,21).
What are the key properties of 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid?
2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid has a molecular weight of 348.36 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)-(oxan-4-yl)amino]acetic acid is sourced from PubChem (CID 126780878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).