About 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole
2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole (PubChem CID 12678092) has the molecular formula C28H20N2O3
and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole |
| PubChem CID | 12678092 |
| Molecular Formula | C28H20N2O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc(COCc4ccc(-c5nc6ccccc6o5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C28H20N2O3/c1-3-7-25-23(5-1)29-27(32-25)21-13-9-19(10-14-21)17-31-18-20-11-15-22(16-12-20)28-30-24-6-2-4-8-26(24)33-28/h1-16H,17-18H2 |
| InChIKey | FZEPHAUHSDFTTD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole?
The IUPAC name of 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole (CID 12678092) is 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole?
The canonical SMILES for 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole is c1ccc2oc(-c3ccc(COCc4ccc(-c5nc6ccccc6o5)cc4)cc3)nc2c1.
What is the InChIKey of 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole?
The InChIKey is FZEPHAUHSDFTTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20N2O3/c1-3-7-25-23(5-1)29-27(32-25)21-13-9-19(10-14-21)17-31-18-20-11-15-22(16-12-20)28-30-24-6-2-4-8-26(24)33-28/h1-16H,17-18H2.
What are the key properties of 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole?
2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole has a molecular weight of 432.48 g/mol, XLogP of 7.02, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxymethyl]phenyl]-1,3-benzoxazole is sourced from PubChem (CID 12678092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).