C17H25ClN2O2 — CID 126781147
1-[3-(1-aminoethyl)piperidin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one;hydrochloride (PubChem CID 126781147) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)piperidin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 126781147 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one;hydrochloride |
| SMILES | COc1cccc(C=CC(=O)N2CCCC(C(C)N)C2)c1.Cl |
| InChI | InChI=1S/C17H24N2O2.ClH/c1-13(18)15-6-4-10-19(12-15)17(20)9-8-14-5-3-7-16(11-14)21-2;/h3,5,7-9,11,13,15H,4,6,10,12,18H2,1-2H3;1H |
| InChIKey | VBKBHSMLPFJSRU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|