C18H30N4O2 — CID 126782517
3-methyl-N-[3-methyl-1-oxo-1-[4-(1H-pyrazol-5-yl)piperidin-1-yl]butan-2-yl]butanamide (PubChem CID 126782517) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-methyl-N-[3-methyl-1-oxo-1-[4-(1H-pyrazol-5-yl)piperidin-1-yl]butan-2-yl]butanamide.
| Compound Name | 3-methyl-N-[3-methyl-1-oxo-1-[4-(1H-pyrazol-5-yl)piperidin-1-yl]butan-2-yl]butanamide |
|---|---|
| PubChem CID | 126782517 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 3-methyl-N-[3-methyl-1-oxo-1-[4-(1H-pyrazol-5-yl)piperidin-1-yl]butan-2-yl]butanamide |
| SMILES | CC(C)CC(=O)NC(C(=O)N1CCC(c2ccn[nH]2)CC1)C(C)C |
| InChI | InChI=1S/C18H30N4O2/c1-12(2)11-16(23)20-17(13(3)4)18(24)22-9-6-14(7-10-22)15-5-8-19-21-15/h5,8,12-14,17H,6-7,9-11H2,1-4H3,(H,19,21)(H,20,23) |
| InChIKey | OJVMVCGKIZQDOD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |