About 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione
2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione (PubChem CID 12678262) has the molecular formula C10H6ClN3O4
and a molecular weight of 267.63 g/mol. Its IUPAC name is 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione |
| PubChem CID | 12678262 |
| Molecular Formula | C10H6ClN3O4 |
| Molecular Weight | 267.63 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione |
| SMILES | NC1=C(Cl)C(=O)c2c(N)ccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C10H6ClN3O4/c11-7-8(13)10(16)6-4(14(17)18)2-1-3(12)5(6)9(7)15/h1-2H,12-13H2 |
| InChIKey | WGCWGPTZWMVQFS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.63 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione?
The IUPAC name of 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione (CID 12678262) is 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione.
What is the SMILES notation for 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione?
The canonical SMILES for 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione is NC1=C(Cl)C(=O)c2c(N)ccc([N+](=O)[O-])c2C1=O.
What is the InChIKey of 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione?
The InChIKey is WGCWGPTZWMVQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClN3O4/c11-7-8(13)10(16)6-4(14(17)18)2-1-3(12)5(6)9(7)15/h1-2H,12-13H2.
What are the key properties of 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione?
2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione has a molecular weight of 267.63 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diamino-3-chloro-8-nitronaphthalene-1,4-dione is sourced from PubChem (CID 12678262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).