C14H19BrN2O4 — CID 126783011
3-[(4-bromo-1-methylpyrrole-2-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid (PubChem CID 126783011) has the molecular formula C14H19BrN2O4 and a molecular weight of 359.22 g/mol. Its IUPAC name is 3-[(4-bromo-1-methylpyrrole-2-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[(4-bromo-1-methylpyrrole-2-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 126783011 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-[(4-bromo-1-methylpyrrole-2-carbonyl)-(oxolan-2-ylmethyl)amino]propanoic acid |
| SMILES | Cn1cc(Br)cc1C(=O)N(CCC(=O)O)CC1CCCO1 |
| InChI | InChI=1S/C14H19BrN2O4/c1-16-8-10(15)7-12(16)14(20)17(5-4-13(18)19)9-11-3-2-6-21-11/h7-8,11H,2-6,9H2,1H3,(H,18,19) |
| InChIKey | MAVWUKRQIPCVRL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |