C14H23N5O3 — CID 126785756
1-(2-amino-2-oxoethyl)-N-(2-cyclohexyl-2-hydroxypropyl)triazole-4-carboxamide (PubChem CID 126785756) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-N-(2-cyclohexyl-2-hydroxypropyl)triazole-4-carboxamide.
| Compound Name | 1-(2-amino-2-oxoethyl)-N-(2-cyclohexyl-2-hydroxypropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 126785756 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-N-(2-cyclohexyl-2-hydroxypropyl)triazole-4-carboxamide |
| SMILES | CC(O)(CNC(=O)c1cn(CC(N)=O)nn1)C1CCCCC1 |
| InChI | InChI=1S/C14H23N5O3/c1-14(22,10-5-3-2-4-6-10)9-16-13(21)11-7-19(18-17-11)8-12(15)20/h7,10,22H,2-6,8-9H2,1H3,(H2,15,20)(H,16,21) |
| InChIKey | IPRIVFPXTYRMQL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |