C19H27ClN2O3 — CID 126785969
3-(2-chlorophenoxy)-N-[[1-(2-methoxyethyl)cyclobutyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 126785969) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-[[1-(2-methoxyethyl)cyclobutyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(2-chlorophenoxy)-N-[[1-(2-methoxyethyl)cyclobutyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126785969 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-[[1-(2-methoxyethyl)cyclobutyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | COCCC1(CNC(=O)N2CCC(Oc3ccccc3Cl)C2)CCC1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-24-12-10-19(8-4-9-19)14-21-18(23)22-11-7-15(13-22)25-17-6-3-2-5-16(17)20/h2-3,5-6,15H,4,7-14H2,1H3,(H,21,23) |
| InChIKey | BCLGOKKEJYSGTQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |