About N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide
N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide (PubChem CID 126786058) has the molecular formula C10H14F3NO
and a molecular weight of 221.22 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide.
Molecular Properties
| Compound Name | N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide |
| PubChem CID | 126786058 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide |
| SMILES | CC(C(=O)NC1CC=CCC1)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO/c1-7(10(11,12)13)9(15)14-8-5-3-2-4-6-8/h2-3,7-8H,4-6H2,1H3,(H,14,15) |
| InChIKey | LAIBLDWERGDKBW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide?
The IUPAC name of N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide (CID 126786058) is N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide.
What is the SMILES notation for N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide?
The canonical SMILES for N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide is CC(C(=O)NC1CC=CCC1)C(F)(F)F.
What is the InChIKey of N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide?
The InChIKey is LAIBLDWERGDKBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO/c1-7(10(11,12)13)9(15)14-8-5-3-2-4-6-8/h2-3,7-8H,4-6H2,1H3,(H,14,15).
What are the key properties of N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide?
N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide has a molecular weight of 221.22 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohex-3-en-1-yl-3,3,3-trifluoro-2-methylpropanamide is sourced from PubChem (CID 126786058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).