About N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine
N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine (PubChem CID 126787216) has the molecular formula C12H17FN2O
and a molecular weight of 224.28 g/mol. Its IUPAC name is N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine |
| PubChem CID | 126787216 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine |
| SMILES | CC1(C)OCCC1NCc1cncc(F)c1 |
| InChI | InChI=1S/C12H17FN2O/c1-12(2)11(3-4-16-12)15-7-9-5-10(13)8-14-6-9/h5-6,8,11,15H,3-4,7H2,1-2H3 |
| InChIKey | IMTVNAFPHAINRV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine?
The IUPAC name of N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine (CID 126787216) is N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine.
What is the SMILES notation for N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine?
The canonical SMILES for N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine is CC1(C)OCCC1NCc1cncc(F)c1.
What is the InChIKey of N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine?
The InChIKey is IMTVNAFPHAINRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FN2O/c1-12(2)11(3-4-16-12)15-7-9-5-10(13)8-14-6-9/h5-6,8,11,15H,3-4,7H2,1-2H3.
What are the key properties of N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine?
N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine has a molecular weight of 224.28 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine is sourced from PubChem (CID 126787216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).