C12H17FN2O — CID 126787216
N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine (PubChem CID 126787216) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine.
| Compound Name | N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 126787216 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[(5-fluoro-3-pyridinyl)methyl]-2,2-dimethyloxolan-3-amine |
| SMILES | CC1(C)OCCC1NCc1cncc(F)c1 |
| InChI | InChI=1S/C12H17FN2O/c1-12(2)11(3-4-16-12)15-7-9-5-10(13)8-14-6-9/h5-6,8,11,15H,3-4,7H2,1-2H3 |
| InChIKey | IMTVNAFPHAINRV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |