C10H11F2NO2 — CID 126787223
N-[1-(difluoromethyl)cyclopropyl]-5-methylfuran-2-carboxamide (PubChem CID 126787223) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is N-[1-(difluoromethyl)cyclopropyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[1-(difluoromethyl)cyclopropyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 126787223 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-[1-(difluoromethyl)cyclopropyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2(C(F)F)CC2)o1 |
| InChI | InChI=1S/C10H11F2NO2/c1-6-2-3-7(15-6)8(14)13-10(4-5-10)9(11)12/h2-3,9H,4-5H2,1H3,(H,13,14) |
| InChIKey | UTTNDRRSGQESGA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |