About 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide
4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide (PubChem CID 126789548) has the molecular formula C19H27N3O2
and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide.
Molecular Properties
| Compound Name | 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide |
| PubChem CID | 126789548 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide |
| SMILES | COCCC(C)(C)C(=O)Nc1cc(CCc2ccccc2C)[nH]n1 |
| InChI | InChI=1S/C19H27N3O2/c1-14-7-5-6-8-15(14)9-10-16-13-17(22-21-16)20-18(23)19(2,3)11-12-24-4/h5-8,13H,9-12H2,1-4H3,(H2,20,21,22,23) |
| InChIKey | GJNKPZKMXLPKPK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide?
The IUPAC name of 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide (CID 126789548) is 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide.
What is the SMILES notation for 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide?
The canonical SMILES for 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide is COCCC(C)(C)C(=O)Nc1cc(CCc2ccccc2C)[nH]n1.
What is the InChIKey of 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide?
The InChIKey is GJNKPZKMXLPKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O2/c1-14-7-5-6-8-15(14)9-10-16-13-17(22-21-16)20-18(23)19(2,3)11-12-24-4/h5-8,13H,9-12H2,1-4H3,(H2,20,21,22,23).
What are the key properties of 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide?
4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide has a molecular weight of 329.44 g/mol, XLogP of 3.50, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,2-dimethyl-N-[5-[2-(2-methylphenyl)ethyl]-1H-pyrazol-3-yl]butanamide is sourced from PubChem (CID 126789548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).