About N-phenyloctan-2-imine
N-phenyloctan-2-imine (PubChem CID 12678979) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is N-phenyloctan-2-imine.
Molecular Properties
| Compound Name | N-phenyloctan-2-imine |
| PubChem CID | 12678979 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-phenyloctan-2-imine |
| SMILES | CCCCCC/C(C)=N/c1ccccc1 |
| InChI | InChI=1S/C14H21N/c1-3-4-5-7-10-13(2)15-14-11-8-6-9-12-14/h6,8-9,11-12H,3-5,7,10H2,1-2H3/b15-13+ |
| InChIKey | TUDBHZZQZNQGKS-FYWRMAATSA-N |
| XLogP | 4.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenyloctan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyloctan-2-imine?
The IUPAC name of N-phenyloctan-2-imine (CID 12678979) is N-phenyloctan-2-imine.
What is the SMILES notation for N-phenyloctan-2-imine?
The canonical SMILES for N-phenyloctan-2-imine is CCCCCC/C(C)=N/c1ccccc1.
What is the InChIKey of N-phenyloctan-2-imine?
The InChIKey is TUDBHZZQZNQGKS-FYWRMAATSA-N. The full InChI is InChI=1S/C14H21N/c1-3-4-5-7-10-13(2)15-14-11-8-6-9-12-14/h6,8-9,11-12H,3-5,7,10H2,1-2H3/b15-13+.
What are the key properties of N-phenyloctan-2-imine?
N-phenyloctan-2-imine has a molecular weight of 203.33 g/mol, XLogP of 4.75, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyloctan-2-imine is sourced from PubChem (CID 12678979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).