C23H35N5O — CID 126790216
N-(azepan-4-yl)-1-tert-butyl-5-propan-2-yl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 126790216) has the molecular formula C23H35N5O and a molecular weight of 397.57 g/mol. Its IUPAC name is N-(azepan-4-yl)-1-tert-butyl-5-propan-2-yl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | N-(azepan-4-yl)-1-tert-butyl-5-propan-2-yl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126790216 |
| Molecular Formula | C23H35N5O |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | N-(azepan-4-yl)-1-tert-butyl-5-propan-2-yl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)N(Cc2ccccn2)C2CCCNCC2)nn1C(C)(C)C |
| InChI | InChI=1S/C23H35N5O/c1-17(2)21-15-20(26-28(21)23(3,4)5)22(29)27(16-18-9-6-7-13-25-18)19-10-8-12-24-14-11-19/h6-7,9,13,15,17,19,24H,8,10-12,14,16H2,1-5H3 |
| InChIKey | HGZCILGZFHJZIC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |