About 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea
3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea (PubChem CID 126790716) has the molecular formula C11H19FN2O
and a molecular weight of 214.28 g/mol. Its IUPAC name is 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea |
| PubChem CID | 126790716 |
| Molecular Formula | C11H19FN2O |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea |
| SMILES | C=CCN(C)C(=O)N[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C11H19FN2O/c1-3-8-14(2)11(15)13-10-7-5-4-6-9(10)12/h3,9-10H,1,4-8H2,2H3,(H,13,15)/t9-,10-/m1/s1 |
| InChIKey | BVOWOURAYHOKPD-NXEZZACHSA-N |
| XLogP | 2.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea?
The IUPAC name of 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea (CID 126790716) is 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea.
What is the SMILES notation for 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea?
The canonical SMILES for 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea is C=CCN(C)C(=O)N[C@@H]1CCCC[C@H]1F.
What is the InChIKey of 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea?
The InChIKey is BVOWOURAYHOKPD-NXEZZACHSA-N. The full InChI is InChI=1S/C11H19FN2O/c1-3-8-14(2)11(15)13-10-7-5-4-6-9(10)12/h3,9-10H,1,4-8H2,2H3,(H,13,15)/t9-,10-/m1/s1.
What are the key properties of 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea?
3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea has a molecular weight of 214.28 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-fluorocyclohexyl]-1-methyl-1-prop-2-enylurea is sourced from PubChem (CID 126790716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).