About N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide
N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide (PubChem CID 126790744) has the molecular formula C9H11FN2OS
and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide |
| PubChem CID | 126790744 |
| Molecular Formula | C9H11FN2OS |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide |
| SMILES | O=C(NC1CCC(F)C1)c1ccsn1 |
| InChI | InChI=1S/C9H11FN2OS/c10-6-1-2-7(5-6)11-9(13)8-3-4-14-12-8/h3-4,6-7H,1-2,5H2,(H,11,13) |
| InChIKey | OXOWPSBCBXVKCG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide?
The IUPAC name of N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide (CID 126790744) is N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide.
What is the SMILES notation for N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide?
The canonical SMILES for N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide is O=C(NC1CCC(F)C1)c1ccsn1.
What is the InChIKey of N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide?
The InChIKey is OXOWPSBCBXVKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2OS/c10-6-1-2-7(5-6)11-9(13)8-3-4-14-12-8/h3-4,6-7H,1-2,5H2,(H,11,13).
What are the key properties of N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide?
N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide has a molecular weight of 214.26 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorocyclopentyl)-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 126790744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).