About N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide
N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide (PubChem CID 126790799) has the molecular formula C11H15FN2O
and a molecular weight of 210.25 g/mol. Its IUPAC name is N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide |
| PubChem CID | 126790799 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1F)c1cc[nH]c1 |
| InChI | InChI=1S/C11H15FN2O/c12-9-3-1-2-4-10(9)14-11(15)8-5-6-13-7-8/h5-7,9-10,13H,1-4H2,(H,14,15)/t9-,10-/m1/s1 |
| InChIKey | QZAMIEVDEPFHSL-NXEZZACHSA-N |
| XLogP | 2.03 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide?
The IUPAC name of N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide (CID 126790799) is N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide.
What is the SMILES notation for N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide?
The canonical SMILES for N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide is O=C(N[C@@H]1CCCC[C@H]1F)c1cc[nH]c1.
What is the InChIKey of N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide?
The InChIKey is QZAMIEVDEPFHSL-NXEZZACHSA-N. The full InChI is InChI=1S/C11H15FN2O/c12-9-3-1-2-4-10(9)14-11(15)8-5-6-13-7-8/h5-7,9-10,13H,1-4H2,(H,14,15)/t9-,10-/m1/s1.
What are the key properties of N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide?
N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide has a molecular weight of 210.25 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-fluorocyclohexyl]-1H-pyrrole-3-carboxamide is sourced from PubChem (CID 126790799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).