About 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide
3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide (PubChem CID 126790846) has the molecular formula C10H17F2NO2
and a molecular weight of 221.25 g/mol. Its IUPAC name is 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide |
| PubChem CID | 126790846 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide |
| SMILES | CC1(O)CC(NC(=O)C(C)(C)C(F)F)C1 |
| InChI | InChI=1S/C10H17F2NO2/c1-9(2,7(11)12)8(14)13-6-4-10(3,15)5-6/h6-7,15H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | QJBBLSHWXBTSIL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide?
The IUPAC name of 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide (CID 126790846) is 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide.
What is the SMILES notation for 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide?
The canonical SMILES for 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide is CC1(O)CC(NC(=O)C(C)(C)C(F)F)C1.
What is the InChIKey of 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide?
The InChIKey is QJBBLSHWXBTSIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO2/c1-9(2,7(11)12)8(14)13-6-4-10(3,15)5-6/h6-7,15H,4-5H2,1-3H3,(H,13,14).
What are the key properties of 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide?
3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide has a molecular weight of 221.25 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-N-(3-hydroxy-3-methylcyclobutyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 126790846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).