C22H21NO3S — CID 126790939
[(3S)-3-hydroxypyrrolidin-1-yl]-(5-phenyl-3-phenylmethoxythiophen-2-yl)methanone (PubChem CID 126790939) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is [(3S)-3-hydroxypyrrolidin-1-yl]-(5-phenyl-3-phenylmethoxythiophen-2-yl)methanone.
| Compound Name | [(3S)-3-hydroxypyrrolidin-1-yl]-(5-phenyl-3-phenylmethoxythiophen-2-yl)methanone |
|---|---|
| PubChem CID | 126790939 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(3S)-3-hydroxypyrrolidin-1-yl]-(5-phenyl-3-phenylmethoxythiophen-2-yl)methanone |
| SMILES | O=C(c1sc(-c2ccccc2)cc1OCc1ccccc1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C22H21NO3S/c24-18-11-12-23(14-18)22(25)21-19(26-15-16-7-3-1-4-8-16)13-20(27-21)17-9-5-2-6-10-17/h1-10,13,18,24H,11-12,14-15H2/t18-/m0/s1 |
| InChIKey | GRLFGHUTOJWXDC-SFHVURJKSA-N |
| XLogP | 4.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |