C14H22F2N4O — CID 126791209
1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-(4,4-dimethylcyclohexyl)urea (PubChem CID 126791209) has the molecular formula C14H22F2N4O and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-(4,4-dimethylcyclohexyl)urea.
| Compound Name | 1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-(4,4-dimethylcyclohexyl)urea |
|---|---|
| PubChem CID | 126791209 |
| Molecular Formula | C14H22F2N4O |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-(4,4-dimethylcyclohexyl)urea |
| SMILES | CC1(C)CCC(NC(=O)Nc2cnn(CC(F)F)c2)CC1 |
| InChI | InChI=1S/C14H22F2N4O/c1-14(2)5-3-10(4-6-14)18-13(21)19-11-7-17-20(8-11)9-12(15)16/h7-8,10,12H,3-6,9H2,1-2H3,(H2,18,19,21) |
| InChIKey | HEHKDLKAIUESMG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |