About N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide
N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide (PubChem CID 12679169) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide.
Molecular Properties
| Compound Name | N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide |
| PubChem CID | 12679169 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-5-4-6-12(2)15(11)17-18-16(19)13-7-9-14(20-3)10-8-13/h4-10,17H,1-3H3,(H,18,19) |
| InChIKey | FCCKQPUBFXGZAS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide?
The IUPAC name of N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide (CID 12679169) is N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide.
What is the SMILES notation for N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide?
The canonical SMILES for N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide is COc1ccc(C(=O)NNc2c(C)cccc2C)cc1.
What is the InChIKey of N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide?
The InChIKey is FCCKQPUBFXGZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-11-5-4-6-12(2)15(11)17-18-16(19)13-7-9-14(20-3)10-8-13/h4-10,17H,1-3H3,(H,18,19).
What are the key properties of N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide?
N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide has a molecular weight of 270.33 g/mol, XLogP of 3.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,6-dimethylphenyl)-4-methoxybenzohydrazide is sourced from PubChem (CID 12679169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).