About (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide
(2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide (PubChem CID 12679254) has the molecular formula C9HN4-
and a molecular weight of 165.13 g/mol. Its IUPAC name is (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide.
Molecular Properties
| Compound Name | (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide |
| PubChem CID | 12679254 |
| Molecular Formula | C9HN4- |
| Molecular Weight | 165.13 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide |
| SMILES | N#CC1=CC(C#N)=C(C#N)C1=C=[N-] |
| InChI | InChI=1S/C9HN4/c10-2-6-1-7(3-11)9(5-13)8(6)4-12/h1H/q-1 |
| InChIKey | PJMOYMIWKJVFKO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.13 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide?
The IUPAC name of (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide (CID 12679254) is (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide.
What is the SMILES notation for (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide?
The canonical SMILES for (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide is N#CC1=CC(C#N)=C(C#N)C1=C=[N-].
What is the InChIKey of (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide?
The InChIKey is PJMOYMIWKJVFKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9HN4/c10-2-6-1-7(3-11)9(5-13)8(6)4-12/h1H/q-1.
What are the key properties of (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide?
(2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide has a molecular weight of 165.13 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5-tricyanocyclopenta-2,4-dien-1-ylidene)methylideneazanide is sourced from PubChem (CID 12679254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).