C12H21N — CID 12679268
N,N,1,2,3,4,5-heptamethylcyclopenta-2,4-dien-1-amine (PubChem CID 12679268) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N,N,1,2,3,4,5-heptamethylcyclopenta-2,4-dien-1-amine.
| Compound Name | N,N,1,2,3,4,5-heptamethylcyclopenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 12679268 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N,N,1,2,3,4,5-heptamethylcyclopenta-2,4-dien-1-amine |
| SMILES | CC1=C(C)C(C)(N(C)C)C(C)=C1C |
| InChI | InChI=1S/C12H21N/c1-8-9(2)11(4)12(5,10(8)3)13(6)7/h1-7H3 |
| InChIKey | HJBYBRLSINVKQY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |