About 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea
1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea (PubChem CID 126792845) has the molecular formula C20H26FN5O2
and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea |
| PubChem CID | 126792845 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea |
| SMILES | COCc1cc(F)ccc1NC(=O)NC1CCN(c2cc(C)nc(C)n2)CC1 |
| InChI | InChI=1S/C20H26FN5O2/c1-13-10-19(23-14(2)22-13)26-8-6-17(7-9-26)24-20(27)25-18-5-4-16(21)11-15(18)12-28-3/h4-5,10-11,17H,6-9,12H2,1-3H3,(H2,24,25,27) |
| InChIKey | ZVIIUOLTMGVZGN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea?
The IUPAC name of 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea (CID 126792845) is 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea.
What is the SMILES notation for 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea?
The canonical SMILES for 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea is COCc1cc(F)ccc1NC(=O)NC1CCN(c2cc(C)nc(C)n2)CC1.
What is the InChIKey of 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea?
The InChIKey is ZVIIUOLTMGVZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FN5O2/c1-13-10-19(23-14(2)22-13)26-8-6-17(7-9-26)24-20(27)25-18-5-4-16(21)11-15(18)12-28-3/h4-5,10-11,17H,6-9,12H2,1-3H3,(H2,24,25,27).
What are the key properties of 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea?
1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea has a molecular weight of 387.46 g/mol, XLogP of 3.17, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-3-[4-fluoro-2-(methoxymethyl)phenyl]urea is sourced from PubChem (CID 126792845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).