About 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine (PubChem CID 126793839) has the molecular formula C11H19FN4
and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine.
Molecular Properties
| Compound Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine |
| PubChem CID | 126793839 |
| Molecular Formula | C11H19FN4 |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine |
| SMILES | CCn1ncnc1CN1CCCC(C)(F)C1 |
| InChI | InChI=1S/C11H19FN4/c1-3-16-10(13-9-14-16)7-15-6-4-5-11(2,12)8-15/h9H,3-8H2,1-2H3 |
| InChIKey | CPAJVFZGAVVWIR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine?
The IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine (CID 126793839) is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine.
What is the SMILES notation for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine?
The canonical SMILES for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine is CCn1ncnc1CN1CCCC(C)(F)C1.
What is the InChIKey of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine?
The InChIKey is CPAJVFZGAVVWIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FN4/c1-3-16-10(13-9-14-16)7-15-6-4-5-11(2,12)8-15/h9H,3-8H2,1-2H3.
What are the key properties of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine?
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine has a molecular weight of 226.30 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-3-methylpiperidine is sourced from PubChem (CID 126793839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).