About 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea
3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea (PubChem CID 126793964) has the molecular formula C10H19FN2O2
and a molecular weight of 218.27 g/mol. Its IUPAC name is 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea |
| PubChem CID | 126793964 |
| Molecular Formula | C10H19FN2O2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea |
| SMILES | CN(CCO)C(=O)N[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C10H19FN2O2/c1-13(6-7-14)10(15)12-9-5-3-2-4-8(9)11/h8-9,14H,2-7H2,1H3,(H,12,15)/t8-,9-/m1/s1 |
| InChIKey | GTWMEVUIDGDABN-RKDXNWHRSA-N |
| XLogP | 0.90 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea?
The IUPAC name of 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea (CID 126793964) is 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea.
What is the SMILES notation for 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea?
The canonical SMILES for 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea is CN(CCO)C(=O)N[C@@H]1CCCC[C@H]1F.
What is the InChIKey of 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea?
The InChIKey is GTWMEVUIDGDABN-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H19FN2O2/c1-13(6-7-14)10(15)12-9-5-3-2-4-8(9)11/h8-9,14H,2-7H2,1H3,(H,12,15)/t8-,9-/m1/s1.
What are the key properties of 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea?
3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea has a molecular weight of 218.27 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-fluorocyclohexyl]-1-(2-hydroxyethyl)-1-methylurea is sourced from PubChem (CID 126793964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).