C10H12FNOS — CID 126794520
[3-(fluoromethyl)azetidin-1-yl]-(4-methylthiophen-3-yl)methanone (PubChem CID 126794520) has the molecular formula C10H12FNOS and a molecular weight of 213.28 g/mol. Its IUPAC name is [3-(fluoromethyl)azetidin-1-yl]-(4-methylthiophen-3-yl)methanone.
| Compound Name | [3-(fluoromethyl)azetidin-1-yl]-(4-methylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 126794520 |
| Molecular Formula | C10H12FNOS |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | [3-(fluoromethyl)azetidin-1-yl]-(4-methylthiophen-3-yl)methanone |
| SMILES | Cc1cscc1C(=O)N1CC(CF)C1 |
| InChI | InChI=1S/C10H12FNOS/c1-7-5-14-6-9(7)10(13)12-3-8(2-11)4-12/h5-6,8H,2-4H2,1H3 |
| InChIKey | GIQRCJIURCGPHJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |