C14H24N4OS — CID 126794865
2-[[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]amino]hex-4-en-1-ol (PubChem CID 126794865) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-[[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]amino]hex-4-en-1-ol.
| Compound Name | 2-[[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]amino]hex-4-en-1-ol |
|---|---|
| PubChem CID | 126794865 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]amino]hex-4-en-1-ol |
| SMILES | CC=CCC(CO)NC1CCN(c2nnc(C)s2)CC1 |
| InChI | InChI=1S/C14H24N4OS/c1-3-4-5-13(10-19)15-12-6-8-18(9-7-12)14-17-16-11(2)20-14/h3-4,12-13,15,19H,5-10H2,1-2H3 |
| InChIKey | ZYJNVOXOUARWRI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|