About (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone
(3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone (PubChem CID 126795407) has the molecular formula C13H20FNO
and a molecular weight of 225.31 g/mol. Its IUPAC name is (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone.
Molecular Properties
| Compound Name | (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone |
| PubChem CID | 126795407 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone |
| SMILES | CC1=CC(C)CN(C(=O)C2(CF)CCC2)C1 |
| InChI | InChI=1S/C13H20FNO/c1-10-6-11(2)8-15(7-10)12(16)13(9-14)4-3-5-13/h6,10H,3-5,7-9H2,1-2H3 |
| InChIKey | UBAVKDBOJWFFOY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone?
The IUPAC name of (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone (CID 126795407) is (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone.
What is the SMILES notation for (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone?
The canonical SMILES for (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone is CC1=CC(C)CN(C(=O)C2(CF)CCC2)C1.
What is the InChIKey of (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone?
The InChIKey is UBAVKDBOJWFFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FNO/c1-10-6-11(2)8-15(7-10)12(16)13(9-14)4-3-5-13/h6,10H,3-5,7-9H2,1-2H3.
What are the key properties of (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone?
(3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone has a molecular weight of 225.31 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(fluoromethyl)cyclobutyl]methanone is sourced from PubChem (CID 126795407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).