C17H28N2O2S — CID 126795411
N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(oxan-4-yl)propanamide (PubChem CID 126795411) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(oxan-4-yl)propanamide.
| Compound Name | N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 126795411 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | N-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-(oxan-4-yl)propanamide |
| SMILES | CC(C(=O)NCCc1nc(C(C)(C)C)cs1)C1CCOCC1 |
| InChI | InChI=1S/C17H28N2O2S/c1-12(13-6-9-21-10-7-13)16(20)18-8-5-15-19-14(11-22-15)17(2,3)4/h11-13H,5-10H2,1-4H3,(H,18,20) |
| InChIKey | QUMMGCRKFMVIPR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |