About N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide
N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide (PubChem CID 126795764) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide.
Molecular Properties
| Compound Name | N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide |
| PubChem CID | 126795764 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(C(=O)N2CCC3(C2)OCc2ccccc23)c1 |
| InChI | InChI=1S/C21H22N2O3/c1-2-19(24)22-17-8-5-7-15(12-17)20(25)23-11-10-21(14-23)18-9-4-3-6-16(18)13-26-21/h3-9,12H,2,10-11,13-14H2,1H3,(H,22,24) |
| InChIKey | LYYLPKVNWIAPRB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide?
The IUPAC name of N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide (CID 126795764) is N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide.
What is the SMILES notation for N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide?
The canonical SMILES for N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide is CCC(=O)Nc1cccc(C(=O)N2CCC3(C2)OCc2ccccc23)c1.
What is the InChIKey of N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide?
The InChIKey is LYYLPKVNWIAPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-2-19(24)22-17-8-5-7-15(12-17)20(25)23-11-10-21(14-23)18-9-4-3-6-16(18)13-26-21/h3-9,12H,2,10-11,13-14H2,1H3,(H,22,24).
What are the key properties of N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide?
N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide has a molecular weight of 350.42 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-carbonyl)phenyl]propanamide is sourced from PubChem (CID 126795764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).