About [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride
[3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (PubChem CID 126796183) has the molecular formula C8H15ClN4O
and a molecular weight of 218.69 g/mol. Its IUPAC name is [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| PubChem CID | 126796183 |
| Molecular Formula | C8H15ClN4O |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1nc(C2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C8H14N4O.ClH/c9-5-7-10-8(12-11-7)6-1-3-13-4-2-6;/h6H,1-5,9H2,(H,10,11,12);1H |
| InChIKey | ZGJDOSRYECELKO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
The IUPAC name of [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (CID 126796183) is [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride.
What is the SMILES notation for [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
The canonical SMILES for [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride is Cl.NCc1nc(C2CCOCC2)n[nH]1.
What is the InChIKey of [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
The InChIKey is ZGJDOSRYECELKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O.ClH/c9-5-7-10-8(12-11-7)6-1-3-13-4-2-6;/h6H,1-5,9H2,(H,10,11,12);1H.
What are the key properties of [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
[3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride has a molecular weight of 218.69 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(oxan-4-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride is sourced from PubChem (CID 126796183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).