C13H14F3NO — CID 126796221
3,3,3-trifluoro-1-(3-phenylpyrrolidin-1-yl)propan-1-one (PubChem CID 126796221) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(3-phenylpyrrolidin-1-yl)propan-1-one.
| Compound Name | 3,3,3-trifluoro-1-(3-phenylpyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 126796221 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3,3,3-trifluoro-1-(3-phenylpyrrolidin-1-yl)propan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C13H14F3NO/c14-13(15,16)8-12(18)17-7-6-11(9-17)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | WVNGREYCDWNMCN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |