About 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine
1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine (PubChem CID 126796727) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine.
Molecular Properties
| Compound Name | 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine |
| PubChem CID | 126796727 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine |
| SMILES | CC(C)Cn1cc(CN2CCOCc3ccccc32)cn1 |
| InChI | InChI=1S/C17H23N3O/c1-14(2)10-20-12-15(9-18-20)11-19-7-8-21-13-16-5-3-4-6-17(16)19/h3-6,9,12,14H,7-8,10-11,13H2,1-2H3 |
| InChIKey | CUXMLSASHRGMLB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine?
The IUPAC name of 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine (CID 126796727) is 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine.
What is the SMILES notation for 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine?
The canonical SMILES for 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine is CC(C)Cn1cc(CN2CCOCc3ccccc32)cn1.
What is the InChIKey of 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine?
The InChIKey is CUXMLSASHRGMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-14(2)10-20-12-15(9-18-20)11-19-7-8-21-13-16-5-3-4-6-17(16)19/h3-6,9,12,14H,7-8,10-11,13H2,1-2H3.
What are the key properties of 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine?
1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine has a molecular weight of 285.39 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3,5-dihydro-2H-4,1-benzoxazepine is sourced from PubChem (CID 126796727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).