C20H30N2O2 — CID 126796768
N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,4-dimethylpent-4-enamide (PubChem CID 126796768) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,4-dimethylpent-4-enamide.
| Compound Name | N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,4-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 126796768 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,4-dimethylpent-4-enamide |
| SMILES | C=C(C)CC(C)C(=O)NC1CCN(Cc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-15(2)12-16(3)20(23)21-18-8-10-22(11-9-18)14-17-6-5-7-19(13-17)24-4/h5-7,13,16,18H,1,8-12,14H2,2-4H3,(H,21,23) |
| InChIKey | IJHYZCDRUSLKIL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|