About 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole
5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 126796885) has the molecular formula C14H25N5O4S
and a molecular weight of 359.45 g/mol. Its IUPAC name is 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole |
| PubChem CID | 126796885 |
| Molecular Formula | C14H25N5O4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole |
| SMILES | CCN(CC)S(=O)(=O)NC1CCCCN(Cc2nc(C)no2)C1=O |
| InChI | InChI=1S/C14H25N5O4S/c1-4-19(5-2)24(21,22)17-12-8-6-7-9-18(14(12)20)10-13-15-11(3)16-23-13/h12,17H,4-10H2,1-3H3 |
| InChIKey | MPUJOTJJETVBKX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole?
The IUPAC name of 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole (CID 126796885) is 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole?
The canonical SMILES for 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole is CCN(CC)S(=O)(=O)NC1CCCCN(Cc2nc(C)no2)C1=O.
What is the InChIKey of 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole?
The InChIKey is MPUJOTJJETVBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5O4S/c1-4-19(5-2)24(21,22)17-12-8-6-7-9-18(14(12)20)10-13-15-11(3)16-23-13/h12,17H,4-10H2,1-3H3.
What are the key properties of 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole?
5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole has a molecular weight of 359.45 g/mol, XLogP of 0.44, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-(diethylsulfamoylamino)-2-oxoazepan-1-yl]methyl]-3-methyl-1,2,4-oxadiazole is sourced from PubChem (CID 126796885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).