C8H15Cl2N3S — CID 126796924
N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;dihydrochloride (PubChem CID 126796924) has the molecular formula C8H15Cl2N3S and a molecular weight of 256.20 g/mol. Its IUPAC name is N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;dihydrochloride.
| Compound Name | N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 126796924 |
| Molecular Formula | C8H15Cl2N3S |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;dihydrochloride |
| SMILES | CN(C)c1nc2c(s1)CNCC2.Cl.Cl |
| InChI | InChI=1S/C8H13N3S.2ClH/c1-11(2)8-10-6-3-4-9-5-7(6)12-8;;/h9H,3-5H2,1-2H3;2*1H |
| InChIKey | FBIIVDJFKSFIGY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |