About 2-(triazol-2-yl)aniline;hydrochloride
2-(triazol-2-yl)aniline;hydrochloride (PubChem CID 126796933) has the molecular formula C8H9ClN4
and a molecular weight of 196.64 g/mol. Its IUPAC name is 2-(triazol-2-yl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 2-(triazol-2-yl)aniline;hydrochloride |
| PubChem CID | 126796933 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2-(triazol-2-yl)aniline;hydrochloride |
| SMILES | Cl.Nc1ccccc1-n1nccn1 |
| InChI | InChI=1S/C8H8N4.ClH/c9-7-3-1-2-4-8(7)12-10-5-6-11-12;/h1-6H,9H2;1H |
| InChIKey | KDEBMOZZTDMUSE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(triazol-2-yl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-2-yl)aniline;hydrochloride?
The IUPAC name of 2-(triazol-2-yl)aniline;hydrochloride (CID 126796933) is 2-(triazol-2-yl)aniline;hydrochloride.
What is the SMILES notation for 2-(triazol-2-yl)aniline;hydrochloride?
The canonical SMILES for 2-(triazol-2-yl)aniline;hydrochloride is Cl.Nc1ccccc1-n1nccn1.
What is the InChIKey of 2-(triazol-2-yl)aniline;hydrochloride?
The InChIKey is KDEBMOZZTDMUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4.ClH/c9-7-3-1-2-4-8(7)12-10-5-6-11-12;/h1-6H,9H2;1H.
What are the key properties of 2-(triazol-2-yl)aniline;hydrochloride?
2-(triazol-2-yl)aniline;hydrochloride has a molecular weight of 196.64 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-2-yl)aniline;hydrochloride is sourced from PubChem (CID 126796933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).