About (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride
(1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride (PubChem CID 126796968) has the molecular formula C5H13Cl2N3
and a molecular weight of 186.09 g/mol. Its IUPAC name is (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride |
| PubChem CID | 126796968 |
| Molecular Formula | C5H13Cl2N3 |
| Molecular Weight | 186.09 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride |
| SMILES | CN1CCN=C1CN.Cl.Cl |
| InChI | InChI=1S/C5H11N3.2ClH/c1-8-3-2-7-5(8)4-6;;/h2-4,6H2,1H3;2*1H |
| InChIKey | DQOXOEOBZZEJTF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.09 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride?
The IUPAC name of (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride (CID 126796968) is (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride.
What is the SMILES notation for (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride?
The canonical SMILES for (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride is CN1CCN=C1CN.Cl.Cl.
What is the InChIKey of (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride?
The InChIKey is DQOXOEOBZZEJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3.2ClH/c1-8-3-2-7-5(8)4-6;;/h2-4,6H2,1H3;2*1H.
What are the key properties of (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride?
(1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride has a molecular weight of 186.09 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-4,5-dihydroimidazol-2-yl)methanamine;dihydrochloride is sourced from PubChem (CID 126796968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).