C13H17N2NaO3 — CID 126797103
sodium (2S)-2-[[2-(4-aminophenyl)acetyl]amino]-3-methylbutanoate (PubChem CID 126797103) has the molecular formula C13H17N2NaO3 and a molecular weight of 272.28 g/mol. Its IUPAC name is sodium (2S)-2-[[2-(4-aminophenyl)acetyl]amino]-3-methylbutanoate.
| Compound Name | sodium (2S)-2-[[2-(4-aminophenyl)acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 126797103 |
| Molecular Formula | C13H17N2NaO3 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | sodium (2S)-2-[[2-(4-aminophenyl)acetyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)Cc1ccc(N)cc1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H18N2O3.Na/c1-8(2)12(13(17)18)15-11(16)7-9-3-5-10(14)6-4-9;/h3-6,8,12H,7,14H2,1-2H3,(H,15,16)(H,17,18);/q;+1/p-1/t12-;/m0./s1 |
| InChIKey | NXPSJRPKRWNBAH-YDALLXLXSA-M |
| XLogP | -3.29 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|