C17H19FN4O — CID 126798112
1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)azetidin-1-yl]-3-(3-fluorophenyl)but-2-en-1-one (PubChem CID 126798112) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)azetidin-1-yl]-3-(3-fluorophenyl)but-2-en-1-one.
| Compound Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)azetidin-1-yl]-3-(3-fluorophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 126798112 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)azetidin-1-yl]-3-(3-fluorophenyl)but-2-en-1-one |
| SMILES | CC(=CC(=O)N1CC(n2nc(C)nc2C)C1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H19FN4O/c1-11(14-5-4-6-15(18)8-14)7-17(23)21-9-16(10-21)22-13(3)19-12(2)20-22/h4-8,16H,9-10H2,1-3H3 |
| InChIKey | CMTNEKCYUAWHKE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|