C13H18N2O3 — CID 126798579
2-(4-methoxyphenyl)-N'-(oxolan-3-yloxy)ethanimidamide (PubChem CID 126798579) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N'-(oxolan-3-yloxy)ethanimidamide.
| Compound Name | 2-(4-methoxyphenyl)-N'-(oxolan-3-yloxy)ethanimidamide |
|---|---|
| PubChem CID | 126798579 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-N'-(oxolan-3-yloxy)ethanimidamide |
| SMILES | COc1ccc(CC(N)=NOC2CCOC2)cc1 |
| InChI | InChI=1S/C13H18N2O3/c1-16-11-4-2-10(3-5-11)8-13(14)15-18-12-6-7-17-9-12/h2-5,12H,6-9H2,1H3,(H2,14,15) |
| InChIKey | MZPWZOVARWUSAU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|