About 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide
2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide (PubChem CID 126799145) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide |
| PubChem CID | 126799145 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide |
| SMILES | CN1CCC(CN(C)C(=O)C(C)(C)C2CC2)CC1 |
| InChI | InChI=1S/C15H28N2O/c1-15(2,13-5-6-13)14(18)17(4)11-12-7-9-16(3)10-8-12/h12-13H,5-11H2,1-4H3 |
| InChIKey | YBNXNSDMELFMGG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide?
The IUPAC name of 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide (CID 126799145) is 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide.
What is the SMILES notation for 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide?
The canonical SMILES for 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide is CN1CCC(CN(C)C(=O)C(C)(C)C2CC2)CC1.
What is the InChIKey of 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide?
The InChIKey is YBNXNSDMELFMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-15(2,13-5-6-13)14(18)17(4)11-12-7-9-16(3)10-8-12/h12-13H,5-11H2,1-4H3.
What are the key properties of 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide?
2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide has a molecular weight of 252.40 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N,2-dimethyl-N-[(1-methylpiperidin-4-yl)methyl]propanamide is sourced from PubChem (CID 126799145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).